C19H22O2 — CID 11000510
(4S,5R)-3-methylidene-4-oct-3-ynyl-5-phenyloxolan-2-one (PubChem CID 11000510) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (4S,5R)-3-methylidene-4-oct-3-ynyl-5-phenyloxolan-2-one.
| Compound Name | (4S,5R)-3-methylidene-4-oct-3-ynyl-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 11000510 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (4S,5R)-3-methylidene-4-oct-3-ynyl-5-phenyloxolan-2-one |
| SMILES | C=C1C(=O)O[C@@H](c2ccccc2)[C@H]1CCC#CCCCC |
| InChI | InChI=1S/C19H22O2/c1-3-4-5-6-7-11-14-17-15(2)19(20)21-18(17)16-12-9-8-10-13-16/h8-10,12-13,17-18H,2-5,11,14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | PVUGIIXPBUKPSQ-ROUUACIJSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|