C15H15NO2 — CID 134989173
4-[(2S,3S)-4-methylidene-5-oxo-2-phenyloxolan-3-yl]butanenitrile (PubChem CID 134989173) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(2S,3S)-4-methylidene-5-oxo-2-phenyloxolan-3-yl]butanenitrile.
| Compound Name | 4-[(2S,3S)-4-methylidene-5-oxo-2-phenyloxolan-3-yl]butanenitrile |
|---|---|
| PubChem CID | 134989173 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-[(2S,3S)-4-methylidene-5-oxo-2-phenyloxolan-3-yl]butanenitrile |
| SMILES | C=C1C(=O)O[C@H](c2ccccc2)[C@H]1CCCC#N |
| InChI | InChI=1S/C15H15NO2/c1-11-13(9-5-6-10-16)14(18-15(11)17)12-7-3-2-4-8-12/h2-4,7-8,13-14H,1,5-6,9H2/t13-,14+/m0/s1 |
| InChIKey | BCVLOYZIDYDXTM-UONOGXRCSA-N |
| XLogP | 3.15 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|