C21H18Cl4N4 — CID 102599145
(8E)-4-(2,4-dichlorophenyl)-8-[(2,4-dichlorophenyl)methylidene]-6-methyl-1,4,5,7-tetrahydropyrido[4,3-d]pyrimidin-2-amine (PubChem CID 102599145) has the molecular formula C21H18Cl4N4 and a molecular weight of 468.22 g/mol. Its IUPAC name is (8E)-4-(2,4-dichlorophenyl)-8-[(2,4-dichlorophenyl)methylidene]-6-methyl-1,4,5,7-tetrahydropyrido[4,3-d]pyrimidin-2-amine.
| Compound Name | (8E)-4-(2,4-dichlorophenyl)-8-[(2,4-dichlorophenyl)methylidene]-6-methyl-1,4,5,7-tetrahydropyrido[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 102599145 |
| Molecular Formula | C21H18Cl4N4 |
| Molecular Weight | 468.22 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | (8E)-4-(2,4-dichlorophenyl)-8-[(2,4-dichlorophenyl)methylidene]-6-methyl-1,4,5,7-tetrahydropyrido[4,3-d]pyrimidin-2-amine |
| SMILES | CN1CC2=C(NC(N)=NC2c2ccc(Cl)cc2Cl)/C(=C/c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C21H18Cl4N4/c1-29-9-12(6-11-2-3-13(22)7-17(11)24)19-16(10-29)20(28-21(26)27-19)15-5-4-14(23)8-18(15)25/h2-8,20H,9-10H2,1H3,(H3,26,27,28)/b12-6+ |
| InChIKey | ASDAXVXBSDMMJQ-WUXMJOGZSA-N |
| XLogP | 5.54 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.22 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |