C20H15Cl4N3O — CID 91899904
(8E)-4-(2,4-dichlorophenyl)-8-[(2,4-dichlorophenyl)methylidene]-3,4,4a,5,6,7-hexahydropyrido[4,3-d]pyrimidin-2-one (PubChem CID 91899904) has the molecular formula C20H15Cl4N3O and a molecular weight of 455.17 g/mol. Its IUPAC name is (8E)-4-(2,4-dichlorophenyl)-8-[(2,4-dichlorophenyl)methylidene]-3,4,4a,5,6,7-hexahydropyrido[4,3-d]pyrimidin-2-one.
| Compound Name | (8E)-4-(2,4-dichlorophenyl)-8-[(2,4-dichlorophenyl)methylidene]-3,4,4a,5,6,7-hexahydropyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 91899904 |
| Molecular Formula | C20H15Cl4N3O |
| Molecular Weight | 455.17 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | (8E)-4-(2,4-dichlorophenyl)-8-[(2,4-dichlorophenyl)methylidene]-3,4,4a,5,6,7-hexahydropyrido[4,3-d]pyrimidin-2-one |
| SMILES | O=C1N=C2/C(=C/c3ccc(Cl)cc3Cl)CNCC2C(c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C20H15Cl4N3O/c21-12-2-1-10(16(23)6-12)5-11-8-25-9-15-18(11)26-20(28)27-19(15)14-4-3-13(22)7-17(14)24/h1-7,15,19,25H,8-9H2,(H,27,28)/b11-5+ |
| InChIKey | ZKAGFOGUOXIEEX-VZUCSPMQSA-N |
| XLogP | 5.81 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.17 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |