C20H19Cl3N2O — CID 58952291
(3aR,4S,5R,7aS)-7a-amino-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one (PubChem CID 58952291) has the molecular formula C20H19Cl3N2O and a molecular weight of 409.74 g/mol. Its IUPAC name is (3aR,4S,5R,7aS)-7a-amino-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one.
| Compound Name | (3aR,4S,5R,7aS)-7a-amino-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58952291 |
| Molecular Formula | C20H19Cl3N2O |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (3aR,4S,5R,7aS)-7a-amino-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
| SMILES | N[C@@]12CC[C@@H](c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1CNC2=O |
| InChI | InChI=1S/C20H19Cl3N2O/c21-12-3-1-11(2-4-12)18-15(14-6-5-13(22)9-17(14)23)7-8-20(24)16(18)10-25-19(20)26/h1-6,9,15-16,18H,7-8,10,24H2,(H,25,26)/t15-,16-,18-,20-/m0/s1 |
| InChIKey | AMBIFSNSHKCTRV-DUPRYPCISA-N |
| XLogP | 4.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |