C10H19F3N2O — CID 102610396
1-(2,2,2-trifluoroethyl)-3-(2,2,3-trimethylbutyl)urea (PubChem CID 102610396) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-3-(2,2,3-trimethylbutyl)urea.
| Compound Name | 1-(2,2,2-trifluoroethyl)-3-(2,2,3-trimethylbutyl)urea |
|---|---|
| PubChem CID | 102610396 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-3-(2,2,3-trimethylbutyl)urea |
| SMILES | CC(C)C(C)(C)CNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-7(2)9(3,4)5-14-8(16)15-6-10(11,12)13/h7H,5-6H2,1-4H3,(H2,14,15,16) |
| InChIKey | SUTKEVFFAHHGQX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |