C13H14INO3 — CID 102614933
6,7-diethoxy-3-iodo-1H-quinolin-4-one (PubChem CID 102614933) has the molecular formula C13H14INO3 and a molecular weight of 359.16 g/mol. Its IUPAC name is 6,7-diethoxy-3-iodo-1H-quinolin-4-one.
| Compound Name | 6,7-diethoxy-3-iodo-1H-quinolin-4-one |
|---|---|
| PubChem CID | 102614933 |
| Molecular Formula | C13H14INO3 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 6,7-diethoxy-3-iodo-1H-quinolin-4-one |
| SMILES | CCOc1cc2[nH]cc(I)c(=O)c2cc1OCC |
| InChI | InChI=1S/C13H14INO3/c1-3-17-11-5-8-10(6-12(11)18-4-2)15-7-9(14)13(8)16/h5-7H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | LALNKHNTUZZXNU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|