C12H14N2O2S — CID 106505559
6,7-diethoxy-1H-quinazoline-4-thione (PubChem CID 106505559) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 6,7-diethoxy-1H-quinazoline-4-thione.
| Compound Name | 6,7-diethoxy-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106505559 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 6,7-diethoxy-1H-quinazoline-4-thione |
| SMILES | CCOc1cc2[nH]cnc(=S)c2cc1OCC |
| InChI | InChI=1S/C12H14N2O2S/c1-3-15-10-5-8-9(6-11(10)16-4-2)13-7-14-12(8)17/h5-7H,3-4H2,1-2H3,(H,13,14,17) |
| InChIKey | MADKSRJMWJSJGO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|