C13H15N5S — CID 10802236
1-[2-(dimethylamino)ethyl]-5H-imidazo[4,5-g]quinazoline-8-thione (PubChem CID 10802236) has the molecular formula C13H15N5S and a molecular weight of 273.37 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-5H-imidazo[4,5-g]quinazoline-8-thione.
| Compound Name | 1-[2-(dimethylamino)ethyl]-5H-imidazo[4,5-g]quinazoline-8-thione |
|---|---|
| PubChem CID | 10802236 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-5H-imidazo[4,5-g]quinazoline-8-thione |
| SMILES | CN(C)CCn1cnc2cc3[nH]cnc(=S)c3cc21 |
| InChI | InChI=1S/C13H15N5S/c1-17(2)3-4-18-8-16-11-6-10-9(5-12(11)18)13(19)15-7-14-10/h5-8H,3-4H2,1-2H3,(H,14,15,19) |
| InChIKey | CDXIIDDNYPGRJQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|