C17H21N7O2 — CID 166272190
N-[1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-N'-(1-methylpyrazol-3-yl)oxamide (PubChem CID 166272190) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-N'-(1-methylpyrazol-3-yl)oxamide.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-N'-(1-methylpyrazol-3-yl)oxamide |
|---|---|
| PubChem CID | 166272190 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]benzimidazol-5-yl]-N'-(1-methylpyrazol-3-yl)oxamide |
| SMILES | CN(C)CCn1cnc2cc(NC(=O)C(=O)Nc3ccn(C)n3)ccc21 |
| InChI | InChI=1S/C17H21N7O2/c1-22(2)8-9-24-11-18-13-10-12(4-5-14(13)24)19-16(25)17(26)20-15-6-7-23(3)21-15/h4-7,10-11H,8-9H2,1-3H3,(H,19,25)(H,20,21,26) |
| InChIKey | OIRWASRMAWASDB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|