C20H24N6O2 — CID 52898750
N-[2-(dimethylamino)ethyl]-2-[5-(phenylcarbamoylamino)benzimidazol-1-yl]acetamide (PubChem CID 52898750) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[5-(phenylcarbamoylamino)benzimidazol-1-yl]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[5-(phenylcarbamoylamino)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 52898750 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[5-(phenylcarbamoylamino)benzimidazol-1-yl]acetamide |
| SMILES | CN(C)CCNC(=O)Cn1cnc2cc(NC(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H24N6O2/c1-25(2)11-10-21-19(27)13-26-14-22-17-12-16(8-9-18(17)26)24-20(28)23-15-6-4-3-5-7-15/h3-9,12,14H,10-11,13H2,1-2H3,(H,21,27)(H2,23,24,28) |
| InChIKey | PXRKWTFHNGUQBK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |