C20H23N3O — CID 32514079
2-(5,6-dimethylbenzimidazol-1-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 32514079) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(5,6-dimethylbenzimidazol-1-yl)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(5,6-dimethylbenzimidazol-1-yl)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 32514079 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-(5,6-dimethylbenzimidazol-1-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1cc2ncn(CC(=O)NCCCc3ccccc3)c2cc1C |
| InChI | InChI=1S/C20H23N3O/c1-15-11-18-19(12-16(15)2)23(14-22-18)13-20(24)21-10-6-9-17-7-4-3-5-8-17/h3-5,7-8,11-12,14H,6,9-10,13H2,1-2H3,(H,21,24) |
| InChIKey | HBFVNCPAXKMLHP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|