C7H10O5 — CID 10261580
3-(hydroxymethyl)-5,5-dimethoxyfuran-2-one (PubChem CID 10261580) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5,5-dimethoxyfuran-2-one.
| Compound Name | 3-(hydroxymethyl)-5,5-dimethoxyfuran-2-one |
|---|---|
| PubChem CID | 10261580 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 3-(hydroxymethyl)-5,5-dimethoxyfuran-2-one |
| SMILES | COC1(OC)C=C(CO)C(=O)O1 |
| InChI | InChI=1S/C7H10O5/c1-10-7(11-2)3-5(4-8)6(9)12-7/h3,8H,4H2,1-2H3 |
| InChIKey | IVUPXAYBOKAQNR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|