C16H14ClFO2 — CID 102616192
4-[(2-chloro-5-fluorophenyl)methoxy]-3,5-dimethylbenzaldehyde (PubChem CID 102616192) has the molecular formula C16H14ClFO2 and a molecular weight of 292.74 g/mol. Its IUPAC name is 4-[(2-chloro-5-fluorophenyl)methoxy]-3,5-dimethylbenzaldehyde.
| Compound Name | 4-[(2-chloro-5-fluorophenyl)methoxy]-3,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 102616192 |
| Molecular Formula | C16H14ClFO2 |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[(2-chloro-5-fluorophenyl)methoxy]-3,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(C=O)cc(C)c1OCc1cc(F)ccc1Cl |
| InChI | InChI=1S/C16H14ClFO2/c1-10-5-12(8-19)6-11(2)16(10)20-9-13-7-14(18)3-4-15(13)17/h3-8H,9H2,1-2H3 |
| InChIKey | CVKCIOPBWBXVMZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|