C8H11BrN2O2S — CID 102618178
5-bromo-3-(4-methoxyoxan-4-yl)-1,2,4-thiadiazole (PubChem CID 102618178) has the molecular formula C8H11BrN2O2S and a molecular weight of 279.16 g/mol. Its IUPAC name is 5-bromo-3-(4-methoxyoxan-4-yl)-1,2,4-thiadiazole.
| Compound Name | 5-bromo-3-(4-methoxyoxan-4-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618178 |
| Molecular Formula | C8H11BrN2O2S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 5-bromo-3-(4-methoxyoxan-4-yl)-1,2,4-thiadiazole |
| SMILES | COC1(c2nsc(Br)n2)CCOCC1 |
| InChI | InChI=1S/C8H11BrN2O2S/c1-12-8(2-4-13-5-3-8)6-10-7(9)14-11-6/h2-5H2,1H3 |
| InChIKey | OMYRESBXNOZNDS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |