C8H13N3O2S — CID 116744803
3-(4-methoxyoxan-4-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 116744803) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 3-(4-methoxyoxan-4-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(4-methoxyoxan-4-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 116744803 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-(4-methoxyoxan-4-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | COC1(c2nsc(N)n2)CCOCC1 |
| InChI | InChI=1S/C8H13N3O2S/c1-12-8(2-4-13-5-3-8)6-10-7(9)14-11-6/h2-5H2,1H3,(H2,9,10,11) |
| InChIKey | QPFYIWYFKZDYLR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |