About methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate
methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate (PubChem CID 10261837) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate.
Analyze methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate?
The IUPAC name of methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate (CID 10261837) is methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate.
What is the SMILES notation for methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate?
The canonical SMILES for methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate is COC(=O)C/C=C1\COC(C)(C)O1.
What is the InChIKey of methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate?
The InChIKey is QUZNIJVALVQHCV-QPJJXVBHSA-N. The full InChI is InChI=1S/C9H14O4/c1-9(2)12-6-7(13-9)4-5-8(10)11-3/h4H,5-6H2,1-3H3/b7-4+.
What are the key properties of methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate?
methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate has a molecular weight of 186.21 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate is sourced from PubChem (CID 10261837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).