C8H4FIN2S — CID 102618423
3-(4-fluorophenyl)-5-iodo-1,2,4-thiadiazole (PubChem CID 102618423) has the molecular formula C8H4FIN2S and a molecular weight of 306.10 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-iodo-1,2,4-thiadiazole.
| Compound Name | 3-(4-fluorophenyl)-5-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618423 |
| Molecular Formula | C8H4FIN2S |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.91 |
| IUPAC Name | 3-(4-fluorophenyl)-5-iodo-1,2,4-thiadiazole |
| SMILES | Fc1ccc(-c2nsc(I)n2)cc1 |
| InChI | InChI=1S/C8H4FIN2S/c9-6-3-1-5(2-4-6)7-11-8(10)13-12-7/h1-4H |
| InChIKey | ISEIWZKMUIQYNF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|