C10H8FIN2S — CID 133058155
[5-(4-fluorophenyl)-2-iodo-1,3-thiazol-4-yl]methanamine (PubChem CID 133058155) has the molecular formula C10H8FIN2S and a molecular weight of 334.16 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-2-iodo-1,3-thiazol-4-yl]methanamine.
| Compound Name | [5-(4-fluorophenyl)-2-iodo-1,3-thiazol-4-yl]methanamine |
|---|---|
| PubChem CID | 133058155 |
| Molecular Formula | C10H8FIN2S |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | [5-(4-fluorophenyl)-2-iodo-1,3-thiazol-4-yl]methanamine |
| SMILES | NCc1nc(I)sc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C10H8FIN2S/c11-7-3-1-6(2-4-7)9-8(5-13)14-10(12)15-9/h1-4H,5,13H2 |
| InChIKey | AWOUYWLUPJPARV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|