C11H10ClNO — CID 10262445
4-[(Z)-8-chlorooct-4-en-2,6-diynyl]azetidin-2-one (PubChem CID 10262445) has the molecular formula C11H10ClNO and a molecular weight of 207.66 g/mol. Its IUPAC name is 4-[(Z)-8-chlorooct-4-en-2,6-diynyl]azetidin-2-one.
| Compound Name | 4-[(Z)-8-chlorooct-4-en-2,6-diynyl]azetidin-2-one |
|---|---|
| PubChem CID | 10262445 |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 4-[(Z)-8-chlorooct-4-en-2,6-diynyl]azetidin-2-one |
| SMILES | O=C1CC(CC#C/C=C\C#CCCl)N1 |
| InChI | InChI=1S/C11H10ClNO/c12-8-6-4-2-1-3-5-7-10-9-11(14)13-10/h1-2,10H,7-9H2,(H,13,14)/b2-1- |
| InChIKey | DLYKXJWCFWMYPU-UPHRSURJSA-N |
| XLogP | 1.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|