C13H20O2 — CID 10262476
[(4aR,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 10262476) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is [(4aR,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(4aR,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 10262476 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | [(4aR,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)OC1=CC[C@@]2(C)CCCC[C@H]2C1 |
| InChI | InChI=1S/C13H20O2/c1-10(14)15-12-6-8-13(2)7-4-3-5-11(13)9-12/h6,11H,3-5,7-9H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | SBZIMDLJFSVSJR-WCQYABFASA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |