C13H18O3 — CID 102408747
[(8S,8aS)-8-hydroxy-8-methyl-5,6,7,8a-tetrahydro-3H-naphthalen-2-yl] acetate (PubChem CID 102408747) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is [(8S,8aS)-8-hydroxy-8-methyl-5,6,7,8a-tetrahydro-3H-naphthalen-2-yl] acetate.
| Compound Name | [(8S,8aS)-8-hydroxy-8-methyl-5,6,7,8a-tetrahydro-3H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 102408747 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | [(8S,8aS)-8-hydroxy-8-methyl-5,6,7,8a-tetrahydro-3H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)OC1=C[C@H]2C(=CC1)CCC[C@]2(C)O |
| InChI | InChI=1S/C13H18O3/c1-9(14)16-11-6-5-10-4-3-7-13(2,15)12(10)8-11/h5,8,12,15H,3-4,6-7H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | KZCZPLTWCIONDP-STQMWFEESA-N |
| XLogP | 2.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|