C17H26N2O2 — CID 102628908
4-amino-N-(4-hydroxy-2-methylphenyl)-2,2,3-trimethylcyclohexane-1-carboxamide (PubChem CID 102628908) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-amino-N-(4-hydroxy-2-methylphenyl)-2,2,3-trimethylcyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(4-hydroxy-2-methylphenyl)-2,2,3-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 102628908 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 4-amino-N-(4-hydroxy-2-methylphenyl)-2,2,3-trimethylcyclohexane-1-carboxamide |
| SMILES | Cc1cc(O)ccc1NC(=O)C1CCC(N)C(C)C1(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-10-9-12(20)5-8-15(10)19-16(21)13-6-7-14(18)11(2)17(13,3)4/h5,8-9,11,13-14,20H,6-7,18H2,1-4H3,(H,19,21) |
| InChIKey | LJSDJFYJWLXBDA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|