C9H8Cl2N4OS — CID 102630102
[5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 102630102) has the molecular formula C9H8Cl2N4OS and a molecular weight of 291.16 g/mol. Its IUPAC name is [5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methanamine.
| Compound Name | [5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 102630102 |
| Molecular Formula | C9H8Cl2N4OS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | [5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methanamine |
| SMILES | NCc1nnc(SCc2cnc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C9H8Cl2N4OS/c10-6-1-7(11)13-3-5(6)4-17-9-15-14-8(2-12)16-9/h1,3H,2,4,12H2 |
| InChIKey | UEYFKNKOGOZYAG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|