C12H13Cl2N5S — CID 116519568
[4-cyclopropyl-5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-1,2,4-triazol-3-yl]methanamine (PubChem CID 116519568) has the molecular formula C12H13Cl2N5S and a molecular weight of 330.24 g/mol. Its IUPAC name is [4-cyclopropyl-5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-cyclopropyl-5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 116519568 |
| Molecular Formula | C12H13Cl2N5S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | [4-cyclopropyl-5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
| SMILES | NCc1nnc(SCc2cnc(Cl)cc2Cl)n1C1CC1 |
| InChI | InChI=1S/C12H13Cl2N5S/c13-9-3-10(14)16-5-7(9)6-20-12-18-17-11(4-15)19(12)8-1-2-8/h3,5,8H,1-2,4,6,15H2 |
| InChIKey | CABWWVZOJBRVDE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|