C12H14ClN5S — CID 63315081
[5-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-cyclopropyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 63315081) has the molecular formula C12H14ClN5S and a molecular weight of 295.80 g/mol. Its IUPAC name is [5-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-cyclopropyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-cyclopropyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63315081 |
| Molecular Formula | C12H14ClN5S |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [5-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-cyclopropyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | NCc1nnc(SCc2ccc(Cl)nc2)n1C1CC1 |
| InChI | InChI=1S/C12H14ClN5S/c13-10-4-1-8(6-15-10)7-19-12-17-16-11(5-14)18(12)9-2-3-9/h1,4,6,9H,2-3,5,7,14H2 |
| InChIKey | KQRUXYRFIIPLED-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|