C9H7ClF3N5S — CID 31048395
3-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine (PubChem CID 31048395) has the molecular formula C9H7ClF3N5S and a molecular weight of 309.70 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 31048395 |
| Molecular Formula | C9H7ClF3N5S |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCc2ccc(Cl)nc2)nnc1C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3N5S/c10-6-2-1-5(3-15-6)4-19-8-17-16-7(18(8)14)9(11,12)13/h1-3H,4,14H2 |
| InChIKey | ZYAYDJJAGDDXSC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|