C14H22N2O4 — CID 102633959
N-(furan-2-ylmethyl)-2-[(6-methylmorpholin-2-yl)methoxy]propanamide (PubChem CID 102633959) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(6-methylmorpholin-2-yl)methoxy]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(6-methylmorpholin-2-yl)methoxy]propanamide |
|---|---|
| PubChem CID | 102633959 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(6-methylmorpholin-2-yl)methoxy]propanamide |
| SMILES | CC1CNCC(COC(C)C(=O)NCc2ccco2)O1 |
| InChI | InChI=1S/C14H22N2O4/c1-10-6-15-7-13(20-10)9-19-11(2)14(17)16-8-12-4-3-5-18-12/h3-5,10-11,13,15H,6-9H2,1-2H3,(H,16,17) |
| InChIKey | SORXMQAORKSMPY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |