C12H17BrN2OS — CID 102638539
N-(2-bromocyclohexyl)-N,2-dimethyl-1,3-thiazole-4-carboxamide (PubChem CID 102638539) has the molecular formula C12H17BrN2OS and a molecular weight of 317.25 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N,2-dimethyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-bromocyclohexyl)-N,2-dimethyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 102638539 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | N-(2-bromocyclohexyl)-N,2-dimethyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)N(C)C2CCCCC2Br)cs1 |
| InChI | InChI=1S/C12H17BrN2OS/c1-8-14-10(7-17-8)12(16)15(2)11-6-4-3-5-9(11)13/h7,9,11H,3-6H2,1-2H3 |
| InChIKey | WTRBCOZCYWSDBG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|