C15H24O2 — CID 102639370
ethyl 2-(2-bicyclo[2.2.1]heptanylmethyl)-2-methylbut-3-enoate (PubChem CID 102639370) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is ethyl 2-(2-bicyclo[2.2.1]heptanylmethyl)-2-methylbut-3-enoate.
| Compound Name | ethyl 2-(2-bicyclo[2.2.1]heptanylmethyl)-2-methylbut-3-enoate |
|---|---|
| PubChem CID | 102639370 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | ethyl 2-(2-bicyclo[2.2.1]heptanylmethyl)-2-methylbut-3-enoate |
| SMILES | C=CC(C)(CC1CC2CCC1C2)C(=O)OCC |
| InChI | InChI=1S/C15H24O2/c1-4-15(3,14(16)17-5-2)10-13-9-11-6-7-12(13)8-11/h4,11-13H,1,5-10H2,2-3H3 |
| InChIKey | KDCHCJNYQDDULC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|