C8H10F2N4O3 — CID 102644879
ethyl 1-(2-amino-2-oxoethyl)-5-(difluoromethyl)triazole-4-carboxylate (PubChem CID 102644879) has the molecular formula C8H10F2N4O3 and a molecular weight of 248.19 g/mol. Its IUPAC name is ethyl 1-(2-amino-2-oxoethyl)-5-(difluoromethyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-(2-amino-2-oxoethyl)-5-(difluoromethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 102644879 |
| Molecular Formula | C8H10F2N4O3 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | ethyl 1-(2-amino-2-oxoethyl)-5-(difluoromethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CC(N)=O)c1C(F)F |
| InChI | InChI=1S/C8H10F2N4O3/c1-2-17-8(16)5-6(7(9)10)14(13-12-5)3-4(11)15/h7H,2-3H2,1H3,(H2,11,15) |
| InChIKey | KUWLEWDREONCCQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |