C11H10BrF2N3O2S — CID 102645036
ethyl 1-[(5-bromothiophen-3-yl)methyl]-5-(difluoromethyl)triazole-4-carboxylate (PubChem CID 102645036) has the molecular formula C11H10BrF2N3O2S and a molecular weight of 366.19 g/mol. Its IUPAC name is ethyl 1-[(5-bromothiophen-3-yl)methyl]-5-(difluoromethyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-[(5-bromothiophen-3-yl)methyl]-5-(difluoromethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 102645036 |
| Molecular Formula | C11H10BrF2N3O2S |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | ethyl 1-[(5-bromothiophen-3-yl)methyl]-5-(difluoromethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2csc(Br)c2)c1C(F)F |
| InChI | InChI=1S/C11H10BrF2N3O2S/c1-2-19-11(18)8-9(10(13)14)17(16-15-8)4-6-3-7(12)20-5-6/h3,5,10H,2,4H2,1H3 |
| InChIKey | DHSPPDKQWDXKJB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |