C13H13F2N3O3 — CID 102644898
ethyl 5-(difluoromethyl)-1-[(3-hydroxyphenyl)methyl]triazole-4-carboxylate (PubChem CID 102644898) has the molecular formula C13H13F2N3O3 and a molecular weight of 297.26 g/mol. Its IUPAC name is ethyl 5-(difluoromethyl)-1-[(3-hydroxyphenyl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-(difluoromethyl)-1-[(3-hydroxyphenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 102644898 |
| Molecular Formula | C13H13F2N3O3 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | ethyl 5-(difluoromethyl)-1-[(3-hydroxyphenyl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2cccc(O)c2)c1C(F)F |
| InChI | InChI=1S/C13H13F2N3O3/c1-2-21-13(20)10-11(12(14)15)18(17-16-10)7-8-4-3-5-9(19)6-8/h3-6,12,19H,2,7H2,1H3 |
| InChIKey | BFISNJXHCCMXNI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |