C13H17NO2 — CID 102647076
3,4-dihydro-2H-pyran-6-yl-(2-methoxyphenyl)methanamine (PubChem CID 102647076) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-6-yl-(2-methoxyphenyl)methanamine.
| Compound Name | 3,4-dihydro-2H-pyran-6-yl-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 102647076 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3,4-dihydro-2H-pyran-6-yl-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1C(N)C1=CCCCO1 |
| InChI | InChI=1S/C13H17NO2/c1-15-11-7-3-2-6-10(11)13(14)12-8-4-5-9-16-12/h2-3,6-8,13H,4-5,9,14H2,1H3 |
| InChIKey | OJJQSQQUUCSVMC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |