C10H17NO — CID 102647501
cyclobutyl(3,4-dihydro-2H-pyran-6-yl)methanamine (PubChem CID 102647501) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is cyclobutyl(3,4-dihydro-2H-pyran-6-yl)methanamine.
| Compound Name | cyclobutyl(3,4-dihydro-2H-pyran-6-yl)methanamine |
|---|---|
| PubChem CID | 102647501 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | cyclobutyl(3,4-dihydro-2H-pyran-6-yl)methanamine |
| SMILES | NC(C1=CCCCO1)C1CCC1 |
| InChI | InChI=1S/C10H17NO/c11-10(8-4-3-5-8)9-6-1-2-7-12-9/h6,8,10H,1-5,7,11H2 |
| InChIKey | IITHMEWCHXKECM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |