C16H27NO — CID 102648051
N-[2-(cyclohexen-1-yl)-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]propan-1-amine (PubChem CID 102648051) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 102648051 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1=CCCCC1)C1=CCCCO1 |
| InChI | InChI=1S/C16H27NO/c1-2-11-17-15(16-10-6-7-12-18-16)13-14-8-4-3-5-9-14/h8,10,15,17H,2-7,9,11-13H2,1H3 |
| InChIKey | GEZIIJIVOWFWEW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|