C11H21NO2 — CID 102648066
1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxypentan-1-amine (PubChem CID 102648066) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxypentan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxypentan-1-amine |
|---|---|
| PubChem CID | 102648066 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxypentan-1-amine |
| SMILES | CCCC(OC)C(N)C1=CCCCO1 |
| InChI | InChI=1S/C11H21NO2/c1-3-6-9(13-2)11(12)10-7-4-5-8-14-10/h7,9,11H,3-6,8,12H2,1-2H3 |
| InChIKey | XZNWSFFEUVWBAG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |