C9H17NO — CID 174454430
(2R)-2-(cyclohexen-1-yloxy)propan-1-amine (PubChem CID 174454430) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (2R)-2-(cyclohexen-1-yloxy)propan-1-amine.
| Compound Name | (2R)-2-(cyclohexen-1-yloxy)propan-1-amine |
|---|---|
| PubChem CID | 174454430 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (2R)-2-(cyclohexen-1-yloxy)propan-1-amine |
| SMILES | C[C@H](CN)OC1=CCCCC1 |
| InChI | InChI=1S/C9H17NO/c1-8(7-10)11-9-5-3-2-4-6-9/h5,8H,2-4,6-7,10H2,1H3/t8-/m1/s1 |
| InChIKey | LCVFNWHQRZZANK-MRVPVSSYSA-N |
| XLogP | 1.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |