About zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide
zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide (PubChem CID 100937759) has the molecular formula C11H19IO2Zn
and a molecular weight of 375.57 g/mol. Its IUPAC name is zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide.
Molecular Properties
| Compound Name | zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide |
| PubChem CID | 100937759 |
| Molecular Formula | C11H19IO2Zn |
| Molecular Weight | 375.57 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide |
| SMILES | C[C@H](C[C@@H](C)[O-])OC1=CCCCC1.[I-].[Zn+2] |
| InChI | InChI=1S/C11H19O2.HI.Zn/c1-9(12)8-10(2)13-11-6-4-3-5-7-11;;/h6,9-10H,3-5,7-8H2,1-2H3;1H;/q-1;;+2/p-1/t9-,10-;;/m1../s1 |
| InChIKey | AYWZZRGKQJXLDG-HSTMFJOWSA-M |
| XLogP | -1.01 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.57 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide?
The IUPAC name of zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide (CID 100937759) is zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide.
What is the SMILES notation for zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide?
The canonical SMILES for zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide is C[C@H](C[C@@H](C)[O-])OC1=CCCCC1.[I-].[Zn+2].
What is the InChIKey of zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide?
The InChIKey is AYWZZRGKQJXLDG-HSTMFJOWSA-M. The full InChI is InChI=1S/C11H19O2.HI.Zn/c1-9(12)8-10(2)13-11-6-4-3-5-7-11;;/h6,9-10H,3-5,7-8H2,1-2H3;1H;/q-1;;+2/p-1/t9-,10-;;/m1../s1.
What are the key properties of zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide?
zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide has a molecular weight of 375.57 g/mol, XLogP of -1.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;(2R,4R)-4-(cyclohexen-1-yloxy)pentan-2-olate;iodide is sourced from PubChem (CID 100937759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).