C15H22O2 — CID 140991633
1-[1-(cyclopenten-1-yloxy)pent-3-enoxy]cyclopentene (PubChem CID 140991633) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-[1-(cyclopenten-1-yloxy)pent-3-enoxy]cyclopentene.
| Compound Name | 1-[1-(cyclopenten-1-yloxy)pent-3-enoxy]cyclopentene |
|---|---|
| PubChem CID | 140991633 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-[1-(cyclopenten-1-yloxy)pent-3-enoxy]cyclopentene |
| SMILES | CC=CCC(OC1=CCCC1)OC1=CCCC1 |
| InChI | InChI=1S/C15H22O2/c1-2-3-12-15(16-13-8-4-5-9-13)17-14-10-6-7-11-14/h2-3,8,10,15H,4-7,9,11-12H2,1H3 |
| InChIKey | NUNZJHMZUACNMX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|