C17H24O5 — CID 57030834
2-[1,2-di(cyclopenten-1-yloxy)ethoxy]ethyl prop-2-enoate (PubChem CID 57030834) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-[1,2-di(cyclopenten-1-yloxy)ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[1,2-di(cyclopenten-1-yloxy)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 57030834 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[1,2-di(cyclopenten-1-yloxy)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(COC1=CCCC1)OC1=CCCC1 |
| InChI | InChI=1S/C17H24O5/c1-2-16(18)19-11-12-20-17(22-15-9-5-6-10-15)13-21-14-7-3-4-8-14/h2,7,9,17H,1,3-6,8,10-13H2 |
| InChIKey | JDANFXYDEDBTNK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|