C16H22O3 — CID 141034957
2,2-di(cyclopenten-1-yl)ethoxymethyl prop-2-enoate (PubChem CID 141034957) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2,2-di(cyclopenten-1-yl)ethoxymethyl prop-2-enoate.
| Compound Name | 2,2-di(cyclopenten-1-yl)ethoxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 141034957 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2,2-di(cyclopenten-1-yl)ethoxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOCC(C1=CCCC1)C1=CCCC1 |
| InChI | InChI=1S/C16H22O3/c1-2-16(17)19-12-18-11-15(13-7-3-4-8-13)14-9-5-6-10-14/h2,7,9,15H,1,3-6,8,10-12H2 |
| InChIKey | HJRPMSSNEXDGOM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|