C18H26O5 — CID 142748718
2-[3,3-di(cyclopenten-1-yloxy)propoxy]ethyl prop-2-enoate (PubChem CID 142748718) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-[3,3-di(cyclopenten-1-yloxy)propoxy]ethyl prop-2-enoate.
| Compound Name | 2-[3,3-di(cyclopenten-1-yloxy)propoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 142748718 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[3,3-di(cyclopenten-1-yloxy)propoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCC(OC1=CCCC1)OC1=CCCC1 |
| InChI | InChI=1S/C18H26O5/c1-2-17(19)21-14-13-20-12-11-18(22-15-7-3-4-8-15)23-16-9-5-6-10-16/h2,7,9,18H,1,3-6,8,10-14H2 |
| InChIKey | NGISFMUTOAVENO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|