C18H24O6 — CID 157373430
4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoic acid;prop-2-enoic acid (PubChem CID 157373430) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoic acid;prop-2-enoic acid.
| Compound Name | 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 157373430 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoic acid;prop-2-enoic acid |
| SMILES | C=C(CC(OC1=CCCC1)OC1=CCCC1)C(=O)O.C=CC(=O)O |
| InChI | InChI=1S/C15H20O4.C3H4O2/c1-11(15(16)17)10-14(18-12-6-2-3-7-12)19-13-8-4-5-9-13;1-2-3(4)5/h6,8,14H,1-5,7,9-10H2,(H,16,17);2H,1H2,(H,4,5) |
| InChIKey | BKANOLFEWSXSKZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|