C20H28O6 — CID 174380078
2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;methyl prop-2-enoate (PubChem CID 174380078) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;methyl prop-2-enoate.
| Compound Name | 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 174380078 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;methyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(OC1=CCCC1)OC1=CCCC1.C=CC(=O)OC |
| InChI | InChI=1S/C16H22O4.C4H6O2/c1-12(2)16(17)18-11-15(19-13-7-3-4-8-13)20-14-9-5-6-10-14;1-3-4(5)6-2/h7,9,15H,1,3-6,8,10-11H2,2H3;3H,1H2,2H3 |
| InChIKey | GJIXQVVDLBODDB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|