C15H20O4 — CID 54163706
di(cyclopenten-1-yloxy)methyl 2-methylprop-2-enoate (PubChem CID 54163706) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is di(cyclopenten-1-yloxy)methyl 2-methylprop-2-enoate.
| Compound Name | di(cyclopenten-1-yloxy)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54163706 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | di(cyclopenten-1-yloxy)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(OC1=CCCC1)OC1=CCCC1 |
| InChI | InChI=1S/C15H20O4/c1-11(2)14(16)19-15(17-12-7-3-4-8-12)18-13-9-5-6-10-13/h7,9,15H,1,3-6,8,10H2,2H3 |
| InChIKey | OQEOYWQDMHWOLJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|