C35H56O5 — CID 141263807
2,2,2-tris[[(1E)-cyclodecen-1-yl]oxy]ethyl prop-2-enoate (PubChem CID 141263807) has the molecular formula C35H56O5 and a molecular weight of 556.83 g/mol. Its IUPAC name is 2,2,2-tris[[(1E)-cyclodecen-1-yl]oxy]ethyl prop-2-enoate.
| Compound Name | 2,2,2-tris[[(1E)-cyclodecen-1-yl]oxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141263807 |
| Molecular Formula | C35H56O5 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | 2,2,2-tris[[(1E)-cyclodecen-1-yl]oxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(O/C1=C/CCCCCCCC1)(O/C1=C/CCCCCCCC1)O/C1=C/CCCCCCCC1 |
| InChI | InChI=1S/C35H56O5/c1-2-34(36)37-30-35(38-31-24-18-12-6-3-7-13-19-25-31,39-32-26-20-14-8-4-9-15-21-27-32)40-33-28-22-16-10-5-11-17-23-29-33/h2,24,26,28H,1,3-23,25,27,29-30H2/b31-24+,32-26+,33-28+ |
| InChIKey | VKKCOGFZYYQWKW-NGPYPVDLSA-N |
| XLogP | 10.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|