C16H26O4 — CID 70218310
1-(cyclohexen-1-yl)-2-(cyclohexen-1-yloxy)-1-ethoxyethane-1,2-diol (PubChem CID 70218310) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-2-(cyclohexen-1-yloxy)-1-ethoxyethane-1,2-diol.
| Compound Name | 1-(cyclohexen-1-yl)-2-(cyclohexen-1-yloxy)-1-ethoxyethane-1,2-diol |
|---|---|
| PubChem CID | 70218310 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-(cyclohexen-1-yl)-2-(cyclohexen-1-yloxy)-1-ethoxyethane-1,2-diol |
| SMILES | CCOC(O)(C1=CCCCC1)C(O)OC1=CCCCC1 |
| InChI | InChI=1S/C16H26O4/c1-2-19-16(18,13-9-5-3-6-10-13)15(17)20-14-11-7-4-8-12-14/h9,11,15,17-18H,2-8,10,12H2,1H3 |
| InChIKey | BNBCLOOSUFSDCE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|