C11H20N2O2 — CID 102649893
[1-(3,4-dihydro-2H-pyran-6-yl)-2-(oxolan-2-yl)ethyl]hydrazine (PubChem CID 102649893) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-6-yl)-2-(oxolan-2-yl)ethyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-(oxolan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102649893 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-(oxolan-2-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CCCO1)C1=CCCCO1 |
| InChI | InChI=1S/C11H20N2O2/c12-13-10(8-9-4-3-7-14-9)11-5-1-2-6-15-11/h5,9-10,13H,1-4,6-8,12H2 |
| InChIKey | SFZRWXZESIXUTG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|