C13H22N2O — CID 102650146
[2-(cyclohexen-1-yl)-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]hydrazine (PubChem CID 102650146) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is [2-(cyclohexen-1-yl)-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]hydrazine.
| Compound Name | [2-(cyclohexen-1-yl)-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102650146 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | [2-(cyclohexen-1-yl)-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]hydrazine |
| SMILES | NNC(CC1=CCCCC1)C1=CCCCO1 |
| InChI | InChI=1S/C13H22N2O/c14-15-12(13-8-4-5-9-16-13)10-11-6-2-1-3-7-11/h6,8,12,15H,1-5,7,9-10,14H2 |
| InChIKey | XWAXQWXQWBOPLP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|